3-(3,5-Dimethoxybenzyloxy)phenylboronic acid

3-(3,5-Dimethoxybenzyloxy)phenylboronic acid is a remarkable substance extensively employed in the field of biomedicine due to its extraordinary characteristics and stands as a prominent cornerstone in the realm of drug discovery and development. Facilitating the synthesis of potential therapeutic agents, this compound proves itself invaluable. Moreover, its substantial impact on disease progression, particularly in cancer treatments, cannot be overlooked, as it showcases formidable inhibitory effects on enzymes or receptors pivotal to the advancement of such ailments. The profound intricacies of its mechanism and its potential as a drug target warrant extensive exploration towards tailored therapeutic interventions.

3-(3,5-Dimethoxybenzyloxy)phenylboronic acid

[3-[(3,5-dimethoxyphenyl)methoxy]phenyl]boronic acid

B(C1=CC(=CC=C1)OCC2=CC(=CC(=C2)OC)OC)(O)O

InChI=1S/C15H17BO5/c1-19-14-6-11(7-15(9-14)20-2)10-21-13-5-3-4-12(8-13)16(17)18/h3-9,17-18H,10H2,1-2H3

AJLNRXRMGFVLDN-UHFFFAOYSA-N

100-105 °C (lit.)

H302-H312-H315-H319-H335

P261-P280-P305 + P351 + P338