5,10,15,20-Tetraphenyl-21H,23H-porphine nickel(II)

5,10,15,20-Tetraphenyl-21H,23H-porphine nickel(II) (NiTPP) is a metalloporphyrin compound with significant potential as a probe in various applications. Its unique photophysical and electrochemical properties make it a valuable tool for detecting specific ions or molecules. For example, it can be used in electrochemical sensors to detect trace amounts of analytes through redox reactions. Additionally, its ability to interact with other molecules and its stability under various conditions make it suitable for studying molecular interactions and probing cellular environments. NiTPP films have also been prepared by thermal evaporation and used to investigate structural and optical properties, showing potential for applications in optoelectronic devices and gas sensors.

5,10,15,20-Tetraphenylporphyrin nickel; Meso-Tetraphenylporphine-Ni(II); Nickel(II) 5,10,15,20-(tetraphenyl)porphyrin; 21H,23H-Porphine, 5,10,15,20-tetraphenyl-, nickel complex; Nickel, [5,10,15,20-tetraphenyl-21H,23H-porphinato(2-)-N,N,N,N]-, (SP-4-1)-; Nickel, [5,10,15,20-tetraphenylporphinato(2-)]-; Nickel, [α,β,γ,δtetraphenylporphinato(2-)]-; (5,10,15,20-Tetraphenylporphyrinato)nickel; (mesoTetraphenylporphinato)nickel; (meso-Tetraphenylporphinato)nickel(II); (meso-Tetraphenylporphyrinato)nickel; (Tetraphenylporphyrinato)nickel; 5,10,15,20-Tetraphenylporphyrin nickel; [5,10,15,20-Tetraphenylporphinato(2-)]nickel; [meso-Tetraphenylporphinato(2-)]nickel; Nickel 5,10,15,20-tetraphenyl-21H,23H-porphyrin; Nickel 5,10,15,20-tetraphenylporphyrin; Nickel meso-tetraphenylporphyrin; Nickel tetraphenylporphine; Nickel tetraphenylporphyrin; Nickel(II) 5,10,15,20-tetraphenylporphine; Nickel(II) mesotetraphenylporphine; Nickel(II) meso-tetraphenylporphyrin; Nickel(II) tetraphenylporphyrin; Tetraphenylporphine nickel complex

nickel(2+);5,10,15,20-tetraphenylporphyrin-22,24-diide

C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)[N-]3.[Ni+2]

InChI=1S/C44H28N4.Ni/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;/h1-28H;/q-2;+2

CXIRWLOIAQYBLZ-UHFFFAOYSA-N

>300 °C

≥95%

Soluble in Benzene (Slightly), Chloroform, Ether (Slightly), Hexane (Slightly), Methanol (Slightly)

Purple crystal

Store at RT

H302 + H312 + H332

P280 - P301 + P312 + P330 - P302 + P352 + P312 - P304 + P340 + P312