2-tert-Butoxymethylphenylboronic acid

2-tert-Butoxymethylphenylboronic acid is an indispensable reagent in biomedicine and holds great promise for combating diverse ailments. Its extensive application in drug discovery, synthesis, and pharmaceutical research signifies its crucial role in these fields. The compound's remarkable potential lies in its ability to inhibit specific enzymes implicated in cancer advancement, rendering it a prime contender for targeted cancer therapy. Moreover, it exhibits auspicious prospects as a pivotal constituent in formulating groundbreaking medications for alleviating inflammation, diabetes, and associated pathologies.

[2-[(2-methylpropan-2-yl)oxymethyl]phenyl]boronic Acid; 2-tert-Butoxymethylphenylboronic acid; 2-tetr-Butoxymethylphenylboronic acid; (2-(tert-Butoxymethyl)phenyl)boronic acid; [2-(tert-butoxymethyl)phenyl]boronic acid; 2-tert-butoxymethylbenzeneboronic acid; 2-(tert-Butoxymethyl)benzeneboronicacid

[2-[(2-methylpropan-2-yl)oxymethyl]phenyl]boronic acid

B(C1=CC=CC=C1COC(C)(C)C)(O)O

InChI=1S/C11H17BO3/c1-11(2,3)15-8-9-6-4-5-7-10(9)12(13)14/h4-7,13-14H,8H2,1-3H3

MKTUWARSDLQBAL-UHFFFAOYSA-N

Not applicable

H302